C23H25N3O5 — CID 175380372
N-[2-methoxy-5-[methyl-(2-oxochromen-3-yl)amino]phenyl]-2-(propanoylamino)propanamide (PubChem CID 175380372) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-[2-methoxy-5-[methyl-(2-oxochromen-3-yl)amino]phenyl]-2-(propanoylamino)propanamide.
| Compound Name | N-[2-methoxy-5-[methyl-(2-oxochromen-3-yl)amino]phenyl]-2-(propanoylamino)propanamide |
|---|---|
| PubChem CID | 175380372 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-[2-methoxy-5-[methyl-(2-oxochromen-3-yl)amino]phenyl]-2-(propanoylamino)propanamide |
| SMILES | CCC(=O)NC(C)C(=O)Nc1cc(N(C)c2cc3ccccc3oc2=O)ccc1OC |
| InChI | InChI=1S/C23H25N3O5/c1-5-21(27)24-14(2)22(28)25-17-13-16(10-11-20(17)30-4)26(3)18-12-15-8-6-7-9-19(15)31-23(18)29/h6-14H,5H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | UCACEXBWINWBOU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|