C22H22N2O4 — CID 175864040
3-[2-[[2-[4-(2-hydroxyethyl)phenyl]pyrimidin-4-yl]methoxy]phenyl]propanoic acid (PubChem CID 175864040) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[2-[[2-[4-(2-hydroxyethyl)phenyl]pyrimidin-4-yl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[[2-[4-(2-hydroxyethyl)phenyl]pyrimidin-4-yl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 175864040 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 3-[2-[[2-[4-(2-hydroxyethyl)phenyl]pyrimidin-4-yl]methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccccc1OCc1ccnc(-c2ccc(CCO)cc2)n1 |
| InChI | InChI=1S/C22H22N2O4/c25-14-12-16-5-7-18(8-6-16)22-23-13-11-19(24-22)15-28-20-4-2-1-3-17(20)9-10-21(26)27/h1-8,11,13,25H,9-10,12,14-15H2,(H,26,27) |
| InChIKey | TUCPSZTZPVVBMG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |