C17H21N3O2 — CID 175864414
3-cyclobutyl-2-ethyl-5-(5-ethyl-1H-1,2,4-triazol-3-yl)benzoic acid (PubChem CID 175864414) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-cyclobutyl-2-ethyl-5-(5-ethyl-1H-1,2,4-triazol-3-yl)benzoic acid.
| Compound Name | 3-cyclobutyl-2-ethyl-5-(5-ethyl-1H-1,2,4-triazol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 175864414 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 3-cyclobutyl-2-ethyl-5-(5-ethyl-1H-1,2,4-triazol-3-yl)benzoic acid |
| SMILES | CCc1nc(-c2cc(C(=O)O)c(CC)c(C3CCC3)c2)n[nH]1 |
| InChI | InChI=1S/C17H21N3O2/c1-3-12-13(10-6-5-7-10)8-11(9-14(12)17(21)22)16-18-15(4-2)19-20-16/h8-10H,3-7H2,1-2H3,(H,21,22)(H,18,19,20) |
| InChIKey | ZLXBZOJUXAENGN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |