C17H22O4 — CID 174669255
cyclohexene;4-ethyl-5-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174669255) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is cyclohexene;4-ethyl-5-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | cyclohexene;4-ethyl-5-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174669255 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | cyclohexene;4-ethyl-5-methylbenzene-1,3-dicarboxylic acid |
| SMILES | C1=CCCCC1.CCc1c(C)cc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C11H12O4.C6H10/c1-3-8-6(2)4-7(10(12)13)5-9(8)11(14)15;1-2-4-6-5-3-1/h4-5H,3H2,1-2H3,(H,12,13)(H,14,15);1-2H,3-6H2 |
| InChIKey | CFWQEKWDYHNKQF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|