4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid

C17H25NO4 — CID 150941772

IUPAC4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid
SMILESCCCCN(CCCC)c1c(C)cc(C(=O)O)cc1C(=O)O
InChIInChI=1S/C17H25NO4/c1-4-6-8-18(9-7-5-2)15-12(3)10-13(16(19)20)11-14(15)17(21)22/h10-11H,4-9H2,1-3H3,(H,19,20)(H,21,22)
InChIKeyLIEYNHOVJDOJRB-UHFFFAOYSA-N
MW307.39 g/mol
LogP3.80
Rot. Bonds9

About 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid

4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid (PubChem CID 150941772) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid
PubChem CID150941772
Molecular FormulaC17H25NO4
Molecular Weight307.39 g/mol
Exact Mass307.18
IUPAC Name4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid
SMILESCCCCN(CCCC)c1c(C)cc(C(=O)O)cc1C(=O)O
InChIInChI=1S/C17H25NO4/c1-4-6-8-18(9-7-5-2)15-12(3)10-13(16(19)20)11-14(15)17(21)22/h10-11H,4-9H2,1-3H3,(H,19,20)(H,21,22)
InChIKeyLIEYNHOVJDOJRB-UHFFFAOYSA-N
XLogP3.80
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.39
LogP ≤ 53.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid (CID 150941772) is 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid is CCCCN(CCCC)c1c(C)cc(C(=O)O)cc1C(=O)O.
What is the InChIKey of 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid?
The InChIKey is LIEYNHOVJDOJRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO4/c1-4-6-8-18(9-7-5-2)15-12(3)10-13(16(19)20)11-14(15)17(21)22/h10-11H,4-9H2,1-3H3,(H,19,20)(H,21,22).
What are the key properties of 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid?
4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid has a molecular weight of 307.39 g/mol, XLogP of 3.80, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 150941772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).