C17H25NO4 — CID 150941772
4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid (PubChem CID 150941772) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150941772 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-(dibutylamino)-5-methylbenzene-1,3-dicarboxylic acid |
| SMILES | CCCCN(CCCC)c1c(C)cc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C17H25NO4/c1-4-6-8-18(9-7-5-2)15-12(3)10-13(16(19)20)11-14(15)17(21)22/h10-11H,4-9H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | LIEYNHOVJDOJRB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |