C27H48O9S2 — CID 175870049
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;sulfo hydrogen sulfate (PubChem CID 175870049) has the molecular formula C27H48O9S2 and a molecular weight of 580.81 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;sulfo hydrogen sulfate.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;sulfo hydrogen sulfate |
|---|---|
| PubChem CID | 175870049 |
| Molecular Formula | C27H48O9S2 |
| Molecular Weight | 580.81 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;sulfo hydrogen sulfate |
| SMILES | CC(CO)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C.O=S(=O)(O)OS(=O)(=O)O |
| InChI | InChI=1S/C27H46O2.H2O7S2/c1-18(17-28)6-5-7-19(2)23-10-11-24-22-9-8-20-16-21(29)12-14-26(20,3)25(22)13-15-27(23,24)4;1-8(2,3)7-9(4,5)6/h8,18-19,21-25,28-29H,5-7,9-17H2,1-4H3;(H,1,2,3)(H,4,5,6)/t18?,19-,21+,22+,23-,24+,25+,26+,27-;/m1./s1 |
| InChIKey | DNKFMZWVKUYKKW-NODJFRKMSA-N |
| XLogP | 4.97 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.81 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|