C8H9NO5 — CID 175871143
(2S)-1-methoxycarbonyl-4-methylidene-5-oxopyrrolidine-2-carboxylic acid (PubChem CID 175871143) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is (2S)-1-methoxycarbonyl-4-methylidene-5-oxopyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-methoxycarbonyl-4-methylidene-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175871143 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | (2S)-1-methoxycarbonyl-4-methylidene-5-oxopyrrolidine-2-carboxylic acid |
| SMILES | C=C1C[C@@H](C(=O)O)N(C(=O)OC)C1=O |
| InChI | InChI=1S/C8H9NO5/c1-4-3-5(7(11)12)9(6(4)10)8(13)14-2/h5H,1,3H2,2H3,(H,11,12)/t5-/m0/s1 |
| InChIKey | LNKGZUZODPPFOY-YFKPBYRVSA-N |
| XLogP | -0.01 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|