C11H16N2O5 — CID 175871102
(2S)-4-[(1-aminocyclopropyl)methyl]-1-methoxycarbonyl-5-oxopyrrolidine-2-carboxylic acid (PubChem CID 175871102) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is (2S)-4-[(1-aminocyclopropyl)methyl]-1-methoxycarbonyl-5-oxopyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-[(1-aminocyclopropyl)methyl]-1-methoxycarbonyl-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175871102 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2S)-4-[(1-aminocyclopropyl)methyl]-1-methoxycarbonyl-5-oxopyrrolidine-2-carboxylic acid |
| SMILES | COC(=O)N1C(=O)C(CC2(N)CC2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C11H16N2O5/c1-18-10(17)13-7(9(15)16)4-6(8(13)14)5-11(12)2-3-11/h6-7H,2-5,12H2,1H3,(H,15,16)/t6?,7-/m0/s1 |
| InChIKey | BELAGNJJLYCJEP-MLWJPKLSSA-N |
| XLogP | -0.06 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |