C21H35NO5 — CID 67365697
bis(3,3-dimethylbutyl) 5-oxo-4-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 67365697) has the molecular formula C21H35NO5 and a molecular weight of 381.51 g/mol. Its IUPAC name is bis(3,3-dimethylbutyl) 5-oxo-4-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | bis(3,3-dimethylbutyl) 5-oxo-4-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67365697 |
| Molecular Formula | C21H35NO5 |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | bis(3,3-dimethylbutyl) 5-oxo-4-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCC1CC(C(=O)OCCC(C)(C)C)N(C(=O)OCCC(C)(C)C)C1=O |
| InChI | InChI=1S/C21H35NO5/c1-8-9-15-14-16(18(24)26-12-10-20(2,3)4)22(17(15)23)19(25)27-13-11-21(5,6)7/h8,15-16H,1,9-14H2,2-7H3 |
| InChIKey | ABOXNSBMPVCAIX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|