C96H182CuN8O8 — CID 175871295
copper 6,7,15,16,24,25,33,34-octaoctoxy-2,11,20,29,38,40-hexaza-37,39-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 175871295) has the molecular formula C96H182CuN8O8 and a molecular weight of 1640.11 g/mol. Its IUPAC name is copper 6,7,15,16,24,25,33,34-octaoctoxy-2,11,20,29,38,40-hexaza-37,39-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | copper 6,7,15,16,24,25,33,34-octaoctoxy-2,11,20,29,38,40-hexaza-37,39-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 175871295 |
| Molecular Formula | C96H182CuN8O8 |
| Molecular Weight | 1640.11 g/mol |
| Exact Mass | 1638.34 |
| IUPAC Name | copper 6,7,15,16,24,25,33,34-octaoctoxy-2,11,20,29,38,40-hexaza-37,39-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | CCCCCCCCOC1CC2C3[N-]C(NC4NC(NC5[N-]C(NC6NC(N3)C3CC(OCCCCCCCC)C(OCCCCCCCC)CC63)C3CC(OCCCCCCCC)C(OCCCCCCCC)CC53)C3CC(OCCCCCCCC)C(OCCCCCCCC)CC43)C2CC1OCCCCCCCC.[Cu+2] |
| InChI | InChI=1S/C96H182N8O8.Cu/c1-9-17-25-33-41-49-57-105-81-65-73-74(66-82(81)106-58-50-42-34-26-18-10-2)90-97-89(73)101-91-75-67-83(107-59-51-43-35-27-19-11-3)84(108-60-52-44-36-28-20-12-4)68-76(75)93(98-91)103-95-79-71-87(111-63-55-47-39-31-23-15-7)88(112-64-56-48-40-32-24-16-8)72-80(79)96(100-95)104-94-78-70-86(110-62-54-46-38-30-22-14-6)85(69-77(78)92(99-94)102-90)109-61-53-45-37-29-21-13-5;/h73-97,100-104H,9-72H2,1-8H3;/q-2;+2 |
| InChIKey | NJPWRQRRUYHYLR-UHFFFAOYSA-N |
| XLogP | 23.02 |
| TPSA | 174.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 64 |
| Heavy Atoms | 113 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1640.11 |
| LogP ≤ 5 | 23.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|