C15H17NO4 — CID 175876328
2-hydroxyethyl 5-(4-methoxyphenyl)-3-methyl-1H-pyrrole-2-carboxylate (PubChem CID 175876328) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-hydroxyethyl 5-(4-methoxyphenyl)-3-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | 2-hydroxyethyl 5-(4-methoxyphenyl)-3-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 175876328 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-hydroxyethyl 5-(4-methoxyphenyl)-3-methyl-1H-pyrrole-2-carboxylate |
| SMILES | COc1ccc(-c2cc(C)c(C(=O)OCCO)[nH]2)cc1 |
| InChI | InChI=1S/C15H17NO4/c1-10-9-13(11-3-5-12(19-2)6-4-11)16-14(10)15(18)20-8-7-17/h3-6,9,16-17H,7-8H2,1-2H3 |
| InChIKey | XTCOVJKLKLRVGV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |