C13H24N4O5S — CID 175876626
[(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;N,N-diethylethanamine (PubChem CID 175876626) has the molecular formula C13H24N4O5S and a molecular weight of 348.43 g/mol. Its IUPAC name is [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;N,N-diethylethanamine.
| Compound Name | [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 175876626 |
| Molecular Formula | C13H24N4O5S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.N#C[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C7H9N3O5S.C6H15N/c8-3-5-1-2-6-4-9(5)7(11)10(6)15-16(12,13)14;1-4-7(5-2)6-3/h5-6H,1-2,4H2,(H,12,13,14);4-6H2,1-3H3/t5-,6+;/m0./s1 |
| InChIKey | DYBILYFJFRBQOY-RIHPBJNCSA-N |
| XLogP | 0.86 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|