C20H28N4O4 — CID 175877412
methyl 1-(4-cyano-2-pyridinyl)piperidine-4-carboxylate;methyl piperidine-4-carboxylate (PubChem CID 175877412) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is methyl 1-(4-cyano-2-pyridinyl)piperidine-4-carboxylate;methyl piperidine-4-carboxylate.
| Compound Name | methyl 1-(4-cyano-2-pyridinyl)piperidine-4-carboxylate;methyl piperidine-4-carboxylate |
|---|---|
| PubChem CID | 175877412 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | methyl 1-(4-cyano-2-pyridinyl)piperidine-4-carboxylate;methyl piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2cc(C#N)ccn2)CC1.COC(=O)C1CCNCC1 |
| InChI | InChI=1S/C13H15N3O2.C7H13NO2/c1-18-13(17)11-3-6-16(7-4-11)12-8-10(9-14)2-5-15-12;1-10-7(9)6-2-4-8-5-3-6/h2,5,8,11H,3-4,6-7H2,1H3;6,8H,2-5H2,1H3 |
| InChIKey | ZYWXRHAJOXZSAS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |