C22H21F3N2O3 — CID 175877542
3,3,3-trifluoroprop-1-en-2-yl 3-[3-(3-methoxyphenyl)indazol-1-yl]-2,2-dimethylpropanoate (PubChem CID 175877542) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is 3,3,3-trifluoroprop-1-en-2-yl 3-[3-(3-methoxyphenyl)indazol-1-yl]-2,2-dimethylpropanoate.
| Compound Name | 3,3,3-trifluoroprop-1-en-2-yl 3-[3-(3-methoxyphenyl)indazol-1-yl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175877542 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 3,3,3-trifluoroprop-1-en-2-yl 3-[3-(3-methoxyphenyl)indazol-1-yl]-2,2-dimethylpropanoate |
| SMILES | C=C(OC(=O)C(C)(C)Cn1nc(-c2cccc(OC)c2)c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C22H21F3N2O3/c1-14(22(23,24)25)30-20(28)21(2,3)13-27-18-11-6-5-10-17(18)19(26-27)15-8-7-9-16(12-15)29-4/h5-12H,1,13H2,2-4H3 |
| InChIKey | QSDJBMMOMGDXJV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|