C23H18ClFO2 — CID 175877796
4-[2-[3-(2-chlorophenyl)-2-methylphenyl]-1-fluoroethenyl]-2-methoxybenzaldehyde (PubChem CID 175877796) has the molecular formula C23H18ClFO2 and a molecular weight of 380.85 g/mol. Its IUPAC name is 4-[2-[3-(2-chlorophenyl)-2-methylphenyl]-1-fluoroethenyl]-2-methoxybenzaldehyde.
| Compound Name | 4-[2-[3-(2-chlorophenyl)-2-methylphenyl]-1-fluoroethenyl]-2-methoxybenzaldehyde |
|---|---|
| PubChem CID | 175877796 |
| Molecular Formula | C23H18ClFO2 |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 4-[2-[3-(2-chlorophenyl)-2-methylphenyl]-1-fluoroethenyl]-2-methoxybenzaldehyde |
| SMILES | COc1cc(C(F)=Cc2cccc(-c3ccccc3Cl)c2C)ccc1C=O |
| InChI | InChI=1S/C23H18ClFO2/c1-15-16(6-5-8-19(15)20-7-3-4-9-21(20)24)12-22(25)17-10-11-18(14-26)23(13-17)27-2/h3-14H,1-2H3 |
| InChIKey | CRBTYSRPFNGFMI-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|