C16H15ClO3 — CID 82039295
3-(3-chloro-2-methylphenyl)-4,5-dimethoxybenzaldehyde (PubChem CID 82039295) has the molecular formula C16H15ClO3 and a molecular weight of 290.75 g/mol. Its IUPAC name is 3-(3-chloro-2-methylphenyl)-4,5-dimethoxybenzaldehyde.
| Compound Name | 3-(3-chloro-2-methylphenyl)-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 82039295 |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-(3-chloro-2-methylphenyl)-4,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)cc(-c2cccc(Cl)c2C)c1OC |
| InChI | InChI=1S/C16H15ClO3/c1-10-12(5-4-6-14(10)17)13-7-11(9-18)8-15(19-2)16(13)20-3/h4-9H,1-3H3 |
| InChIKey | XHXNXTXUFWOXNJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|