C17H17ClFN3OS — CID 175878359
tert-butyl-[[(R)-(3-chloro-4-fluorophenyl)-(6-cyano-2-pyridinyl)methyl]amino]-oxidosulfanium (PubChem CID 175878359) has the molecular formula C17H17ClFN3OS and a molecular weight of 365.86 g/mol. Its IUPAC name is tert-butyl-[[(R)-(3-chloro-4-fluorophenyl)-(6-cyano-2-pyridinyl)methyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(R)-(3-chloro-4-fluorophenyl)-(6-cyano-2-pyridinyl)methyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175878359 |
| Molecular Formula | C17H17ClFN3OS |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | tert-butyl-[[(R)-(3-chloro-4-fluorophenyl)-(6-cyano-2-pyridinyl)methyl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@H](c1ccc(F)c(Cl)c1)c1cccc(C#N)n1 |
| InChI | InChI=1S/C17H17ClFN3OS/c1-17(2,3)24(23)22-16(11-7-8-14(19)13(18)9-11)15-6-4-5-12(10-20)21-15/h4-9,16,22H,1-3H3/t16-,24?/m1/s1 |
| InChIKey | IHMMAKCJPNQSTI-YAOANENCSA-N |
| XLogP | 3.89 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|