C19H21N7O2 — CID 175881886
N-[2-oxo-2-(4-piperazin-1-ylanilino)ethyl]pyrrolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 175881886) has the molecular formula C19H21N7O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[2-oxo-2-(4-piperazin-1-ylanilino)ethyl]pyrrolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N-[2-oxo-2-(4-piperazin-1-ylanilino)ethyl]pyrrolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 175881886 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-[2-oxo-2-(4-piperazin-1-ylanilino)ethyl]pyrrolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | O=C(CNC(=O)n1ccc2cncnc21)Nc1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C19H21N7O2/c27-17(12-22-19(28)26-8-5-14-11-21-13-23-18(14)26)24-15-1-3-16(4-2-15)25-9-6-20-7-10-25/h1-5,8,11,13,20H,6-7,9-10,12H2,(H,22,28)(H,24,27) |
| InChIKey | RYOVZZWMBZPNJU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|