C18H24N6O3 — CID 46908243
2-[(1S)-1-aminoethyl]-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1H-imidazole-5-carboxamide (PubChem CID 46908243) has the molecular formula C18H24N6O3 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1H-imidazole-5-carboxamide.
| Compound Name | 2-[(1S)-1-aminoethyl]-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 46908243 |
| Molecular Formula | C18H24N6O3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1H-imidazole-5-carboxamide |
| SMILES | C[C@H](N)c1ncc(C(=O)NCC(=O)Nc2ccc(N3CCOCC3)cc2)[nH]1 |
| InChI | InChI=1S/C18H24N6O3/c1-12(19)17-20-10-15(23-17)18(26)21-11-16(25)22-13-2-4-14(5-3-13)24-6-8-27-9-7-24/h2-5,10,12H,6-9,11,19H2,1H3,(H,20,23)(H,21,26)(H,22,25)/t12-/m0/s1 |
| InChIKey | UDHCBCNTDKCCSJ-LBPRGKRZSA-N |
| XLogP | 0.63 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|