C15H15F3N2O2 — CID 175883493
2-[1-[2-(2,2,2-trifluoroethoxy)ethyl]indol-5-yl]prop-2-enamide (PubChem CID 175883493) has the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is 2-[1-[2-(2,2,2-trifluoroethoxy)ethyl]indol-5-yl]prop-2-enamide.
| Compound Name | 2-[1-[2-(2,2,2-trifluoroethoxy)ethyl]indol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 175883493 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-[1-[2-(2,2,2-trifluoroethoxy)ethyl]indol-5-yl]prop-2-enamide |
| SMILES | C=C(C(N)=O)c1ccc2c(ccn2CCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3N2O2/c1-10(14(19)21)11-2-3-13-12(8-11)4-5-20(13)6-7-22-9-15(16,17)18/h2-5,8H,1,6-7,9H2,(H2,19,21) |
| InChIKey | PMIWTPKGRMJDBY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|