(1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid

C8H13NO2 — CID 175884056

IUPAC(1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid
SMILESCC1(C)[C@@H]2CNC[C@@]21C(=O)O
InChIInChI=1S/C8H13NO2/c1-7(2)5-3-9-4-8(5,7)6(10)11/h5,9H,3-4H2,1-2H3,(H,10,11)/t5-,8-/m0/s1
InChIKeyKJFXAGXVKWKPPF-XNCJUZBTSA-N
MW155.20 g/mol
LogP0.32
Rot. Bonds1

About (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid

(1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid (PubChem CID 175884056) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid.

Molecular Properties

Compound Name(1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid
PubChem CID175884056
Molecular FormulaC8H13NO2
Molecular Weight155.20 g/mol
Exact Mass155.09
IUPAC Name(1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid
SMILESCC1(C)[C@@H]2CNC[C@@]21C(=O)O
InChIInChI=1S/C8H13NO2/c1-7(2)5-3-9-4-8(5,7)6(10)11/h5,9H,3-4H2,1-2H3,(H,10,11)/t5-,8-/m0/s1
InChIKeyKJFXAGXVKWKPPF-XNCJUZBTSA-N
XLogP0.32
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.20
LogP ≤ 50.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid?
The IUPAC name of (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid (CID 175884056) is (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid.
What is the SMILES notation for (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid?
The canonical SMILES for (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid is CC1(C)[C@@H]2CNC[C@@]21C(=O)O.
What is the InChIKey of (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid?
The InChIKey is KJFXAGXVKWKPPF-XNCJUZBTSA-N. The full InChI is InChI=1S/C8H13NO2/c1-7(2)5-3-9-4-8(5,7)6(10)11/h5,9H,3-4H2,1-2H3,(H,10,11)/t5-,8-/m0/s1.
What are the key properties of (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid?
(1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid has a molecular weight of 155.20 g/mol, XLogP of 0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid is sourced from PubChem (CID 175884056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).