About 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid
2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid (PubChem CID 156540404) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid |
| PubChem CID | 156540404 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid |
| SMILES | CC12CNC[C@H]1[C@@H]2CC(=O)O |
| InChI | InChI=1S/C8H13NO2/c1-8-4-9-3-6(8)5(8)2-7(10)11/h5-6,9H,2-4H2,1H3,(H,10,11)/t5-,6-,8?/m0/s1 |
| InChIKey | UEUSOEBZIWBOFP-AJFZSALYSA-N |
| XLogP | 0.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid?
The IUPAC name of 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid (CID 156540404) is 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid.
What is the SMILES notation for 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid?
The canonical SMILES for 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid is CC12CNC[C@H]1[C@@H]2CC(=O)O.
What is the InChIKey of 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid?
The InChIKey is UEUSOEBZIWBOFP-AJFZSALYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-8-4-9-3-6(8)5(8)2-7(10)11/h5-6,9H,2-4H2,1H3,(H,10,11)/t5-,6-,8?/m0/s1.
What are the key properties of 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid?
2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid has a molecular weight of 155.20 g/mol, XLogP of 0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5S,6S)-1-methyl-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid is sourced from PubChem (CID 156540404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).