C8H12O3 — CID 44631748
2-[(1S,3R)-3-formyl-2,2-dimethylcyclopropyl]acetic acid (PubChem CID 44631748) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-[(1S,3R)-3-formyl-2,2-dimethylcyclopropyl]acetic acid.
| Compound Name | 2-[(1S,3R)-3-formyl-2,2-dimethylcyclopropyl]acetic acid |
|---|---|
| PubChem CID | 44631748 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2-[(1S,3R)-3-formyl-2,2-dimethylcyclopropyl]acetic acid |
| SMILES | CC1(C)[C@H](C=O)[C@@H]1CC(=O)O |
| InChI | InChI=1S/C8H12O3/c1-8(2)5(3-7(10)11)6(8)4-9/h4-6H,3H2,1-2H3,(H,10,11)/t5-,6+/m0/s1 |
| InChIKey | UFJZZVVGUYTOSA-NTSWFWBYSA-N |
| XLogP | 0.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|