C8H14O3 — CID 23393208
2,2-dimethyl-3-(methylperoxymethyl)cyclopropane-1-carbaldehyde (PubChem CID 23393208) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2,2-dimethyl-3-(methylperoxymethyl)cyclopropane-1-carbaldehyde.
| Compound Name | 2,2-dimethyl-3-(methylperoxymethyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 23393208 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2,2-dimethyl-3-(methylperoxymethyl)cyclopropane-1-carbaldehyde |
| SMILES | COOCC1C(C=O)C1(C)C |
| InChI | InChI=1S/C8H14O3/c1-8(2)6(4-9)7(8)5-11-10-3/h4,6-7H,5H2,1-3H3 |
| InChIKey | GOEIXFYAILHTLI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|