C9H14O3 — CID 100961637
2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid (PubChem CID 100961637) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid.
| Compound Name | 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid |
|---|---|
| PubChem CID | 100961637 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid |
| SMILES | CC1(C)[C@H](CC(=O)O)C[C@@H]1C=O |
| InChI | InChI=1S/C9H14O3/c1-9(2)6(4-8(11)12)3-7(9)5-10/h5-7H,3-4H2,1-2H3,(H,11,12)/t6-,7+/m0/s1 |
| InChIKey | ZIHACHGWZKWKDY-NKWVEPMBSA-N |
| XLogP | 1.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|