2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid

C9H14O3 — CID 100961637

IUPAC2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid
SMILESCC1(C)[C@H](CC(=O)O)C[C@@H]1C=O
InChIInChI=1S/C9H14O3/c1-9(2)6(4-8(11)12)3-7(9)5-10/h5-7H,3-4H2,1-2H3,(H,11,12)/t6-,7+/m0/s1
InChIKeyZIHACHGWZKWKDY-NKWVEPMBSA-N
MW170.21 g/mol
LogP1.32
Rot. Bonds3

About 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid

2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid (PubChem CID 100961637) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid.

Molecular Properties

Compound Name2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid
PubChem CID100961637
Molecular FormulaC9H14O3
Molecular Weight170.21 g/mol
Exact Mass170.09
IUPAC Name2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid
SMILESCC1(C)[C@H](CC(=O)O)C[C@@H]1C=O
InChIInChI=1S/C9H14O3/c1-9(2)6(4-8(11)12)3-7(9)5-10/h5-7H,3-4H2,1-2H3,(H,11,12)/t6-,7+/m0/s1
InChIKeyZIHACHGWZKWKDY-NKWVEPMBSA-N
XLogP1.32
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.21
LogP ≤ 51.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid?
The IUPAC name of 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid (CID 100961637) is 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid.
What is the SMILES notation for 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid?
The canonical SMILES for 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid is CC1(C)[C@H](CC(=O)O)C[C@@H]1C=O.
What is the InChIKey of 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid?
The InChIKey is ZIHACHGWZKWKDY-NKWVEPMBSA-N. The full InChI is InChI=1S/C9H14O3/c1-9(2)6(4-8(11)12)3-7(9)5-10/h5-7H,3-4H2,1-2H3,(H,11,12)/t6-,7+/m0/s1.
What are the key properties of 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid?
2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid has a molecular weight of 170.21 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,3S)-3-formyl-2,2-dimethylcyclobutyl]acetic acid is sourced from PubChem (CID 100961637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).