C21H26N6O — CID 175884083
1-[4-[5-amino-3-(4-aminophenyl)imidazo[1,5-c]pyrimidin-1-yl]piperidin-1-yl]-2-methylpropan-1-one (PubChem CID 175884083) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-[4-[5-amino-3-(4-aminophenyl)imidazo[1,5-c]pyrimidin-1-yl]piperidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-[5-amino-3-(4-aminophenyl)imidazo[1,5-c]pyrimidin-1-yl]piperidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 175884083 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1-[4-[5-amino-3-(4-aminophenyl)imidazo[1,5-c]pyrimidin-1-yl]piperidin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCC(c2nc(-c3ccc(N)cc3)n3c(N)nccc23)CC1 |
| InChI | InChI=1S/C21H26N6O/c1-13(2)20(28)26-11-8-14(9-12-26)18-17-7-10-24-21(23)27(17)19(25-18)15-3-5-16(22)6-4-15/h3-7,10,13-14H,8-9,11-12,22H2,1-2H3,(H2,23,24) |
| InChIKey | VVYQJSYUGKEOLL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|