C8H15N7O2 — CID 175885184
butyl N-(1,3-diazidopropan-2-yl)carbamate (PubChem CID 175885184) has the molecular formula C8H15N7O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is butyl N-(1,3-diazidopropan-2-yl)carbamate.
| Compound Name | butyl N-(1,3-diazidopropan-2-yl)carbamate |
|---|---|
| PubChem CID | 175885184 |
| Molecular Formula | C8H15N7O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | butyl N-(1,3-diazidopropan-2-yl)carbamate |
| SMILES | CCCCOC(=O)NC(CN=[N+]=[N-])CN=[N+]=[N-] |
| InChI | InChI=1S/C8H15N7O2/c1-2-3-4-17-8(16)13-7(5-11-14-9)6-12-15-10/h7H,2-6H2,1H3,(H,13,16) |
| InChIKey | BBGAJRVIOFTUEO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|