C11H17N3O — CID 175886329
(3-butyl-5,6-dihydroimidazo[1,2-a]pyrazin-2-yl)methanol (PubChem CID 175886329) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is (3-butyl-5,6-dihydroimidazo[1,2-a]pyrazin-2-yl)methanol.
| Compound Name | (3-butyl-5,6-dihydroimidazo[1,2-a]pyrazin-2-yl)methanol |
|---|---|
| PubChem CID | 175886329 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (3-butyl-5,6-dihydroimidazo[1,2-a]pyrazin-2-yl)methanol |
| SMILES | CCCCc1c(CO)nc2n1CCN=C2 |
| InChI | InChI=1S/C11H17N3O/c1-2-3-4-10-9(8-15)13-11-7-12-5-6-14(10)11/h7,15H,2-6,8H2,1H3 |
| InChIKey | OOOUWNNZXZINFC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |