C15H26N2S — CID 67919408
5,6-dipentyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 67919408) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is 5,6-dipentyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5,6-dipentyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 67919408 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 5,6-dipentyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CCCCCc1nc2n(c1CCCCC)CCS2 |
| InChI | InChI=1S/C15H26N2S/c1-3-5-7-9-13-14(10-8-6-4-2)17-11-12-18-15(17)16-13/h3-12H2,1-2H3 |
| InChIKey | XKMAWHHOUFGMNW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|