C19H20N4O3 — CID 175889009
3-(3,3-dimethyl-1,2-dihydropyrrol-5-yl)-N-(6-methyl-5-nitro-3-pyridinyl)benzamide (PubChem CID 175889009) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-(3,3-dimethyl-1,2-dihydropyrrol-5-yl)-N-(6-methyl-5-nitro-3-pyridinyl)benzamide.
| Compound Name | 3-(3,3-dimethyl-1,2-dihydropyrrol-5-yl)-N-(6-methyl-5-nitro-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 175889009 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-(3,3-dimethyl-1,2-dihydropyrrol-5-yl)-N-(6-methyl-5-nitro-3-pyridinyl)benzamide |
| SMILES | Cc1ncc(NC(=O)c2cccc(C3=CC(C)(C)CN3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N4O3/c1-12-17(23(25)26)8-15(10-20-12)22-18(24)14-6-4-5-13(7-14)16-9-19(2,3)11-21-16/h4-10,21H,11H2,1-3H3,(H,22,24) |
| InChIKey | WCWQSFNYSDWTPU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|