C14H19O6P — CID 175889765
(3,5-diformylphenyl) dipropan-2-yl phosphate (PubChem CID 175889765) has the molecular formula C14H19O6P and a molecular weight of 314.27 g/mol. Its IUPAC name is (3,5-diformylphenyl) dipropan-2-yl phosphate.
| Compound Name | (3,5-diformylphenyl) dipropan-2-yl phosphate |
|---|---|
| PubChem CID | 175889765 |
| Molecular Formula | C14H19O6P |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (3,5-diformylphenyl) dipropan-2-yl phosphate |
| SMILES | CC(C)OP(=O)(Oc1cc(C=O)cc(C=O)c1)OC(C)C |
| InChI | InChI=1S/C14H19O6P/c1-10(2)18-21(17,19-11(3)4)20-14-6-12(8-15)5-13(7-14)9-16/h5-11H,1-4H3 |
| InChIKey | RZWUEKGDWRLBPZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|