C4H14N14O6 — CID 175891194
2-[[[amino-(diaminomethylideneamino)methylidene]amino]diazenyl]-1-(diaminomethylidene)guanidine;bis(nitric acid) (PubChem CID 175891194) has the molecular formula C4H14N14O6 and a molecular weight of 354.25 g/mol. Its IUPAC name is 2-[[[amino-(diaminomethylideneamino)methylidene]amino]diazenyl]-1-(diaminomethylidene)guanidine;bis(nitric acid).
| Compound Name | 2-[[[amino-(diaminomethylideneamino)methylidene]amino]diazenyl]-1-(diaminomethylidene)guanidine;bis(nitric acid) |
|---|---|
| PubChem CID | 175891194 |
| Molecular Formula | C4H14N14O6 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[[[amino-(diaminomethylideneamino)methylidene]amino]diazenyl]-1-(diaminomethylidene)guanidine;bis(nitric acid) |
| SMILES | NC(N)=NC(N)=NN=NN=C(N)N=C(N)N.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C4H12N12.2HNO3/c5-1(6)11-3(9)13-15-16-14-4(10)12-2(7)8;2*2-1(3)4/h(H6,5,6,9,11,13,16)(H6,7,8,10,12,14,15);2*(H,2,3,4) |
| InChIKey | RWDRJIDROOVCDS-UHFFFAOYSA-N |
| XLogP | -4.25 |
| TPSA | 357.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|