C23H27F3N6O2 — CID 175891250
4-[[(2R)-4,4-dimethyloxetan-2-yl]methoxy]-N-[(1R,3S)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclohexyl]-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 175891250) has the molecular formula C23H27F3N6O2 and a molecular weight of 476.50 g/mol. Its IUPAC name is 4-[[(2R)-4,4-dimethyloxetan-2-yl]methoxy]-N-[(1R,3S)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclohexyl]-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-[[(2R)-4,4-dimethyloxetan-2-yl]methoxy]-N-[(1R,3S)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclohexyl]-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 175891250 |
| Molecular Formula | C23H27F3N6O2 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 4-[[(2R)-4,4-dimethyloxetan-2-yl]methoxy]-N-[(1R,3S)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclohexyl]-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CC1(C)C[C@H](COc2nc(N[C@@H]3CCC[C@H](c4nnc5ccccn45)C3)ncc2C(F)(F)F)O1 |
| InChI | InChI=1S/C23H27F3N6O2/c1-22(2)11-16(34-22)13-33-20-17(23(24,25)26)12-27-21(29-20)28-15-7-5-6-14(10-15)19-31-30-18-8-3-4-9-32(18)19/h3-4,8-9,12,14-16H,5-7,10-11,13H2,1-2H3,(H,27,28,29)/t14-,15+,16+/m0/s1 |
| InChIKey | KJVTYRRUYJMBRW-ARFHVFGLSA-N |
| XLogP | 4.62 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |