C18H30N2O4 — CID 175893109
butyl (2S)-3-methyl-2-[methyl-[(3S)-1-prop-2-enoylpyrrolidine-3-carbonyl]amino]butanoate (PubChem CID 175893109) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is butyl (2S)-3-methyl-2-[methyl-[(3S)-1-prop-2-enoylpyrrolidine-3-carbonyl]amino]butanoate.
| Compound Name | butyl (2S)-3-methyl-2-[methyl-[(3S)-1-prop-2-enoylpyrrolidine-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 175893109 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | butyl (2S)-3-methyl-2-[methyl-[(3S)-1-prop-2-enoylpyrrolidine-3-carbonyl]amino]butanoate |
| SMILES | C=CC(=O)N1CC[C@H](C(=O)N(C)[C@H](C(=O)OCCCC)C(C)C)C1 |
| InChI | InChI=1S/C18H30N2O4/c1-6-8-11-24-18(23)16(13(3)4)19(5)17(22)14-9-10-20(12-14)15(21)7-2/h7,13-14,16H,2,6,8-12H2,1,3-5H3/t14-,16-/m0/s1 |
| InChIKey | CZOXWYGNGSNLBG-HOCLYGCPSA-N |
| XLogP | 1.85 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|