C17H29BrN2O4 — CID 156678981
tert-butyl (2S)-2-[[(3S)-1-(2-bromoacetyl)pyrrolidine-3-carbonyl]-methylamino]-3-methylbutanoate (PubChem CID 156678981) has the molecular formula C17H29BrN2O4 and a molecular weight of 405.33 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(3S)-1-(2-bromoacetyl)pyrrolidine-3-carbonyl]-methylamino]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[(3S)-1-(2-bromoacetyl)pyrrolidine-3-carbonyl]-methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 156678981 |
| Molecular Formula | C17H29BrN2O4 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | tert-butyl (2S)-2-[[(3S)-1-(2-bromoacetyl)pyrrolidine-3-carbonyl]-methylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)OC(C)(C)C)N(C)C(=O)[C@H]1CCN(C(=O)CBr)C1 |
| InChI | InChI=1S/C17H29BrN2O4/c1-11(2)14(16(23)24-17(3,4)5)19(6)15(22)12-7-8-20(10-12)13(21)9-18/h11-12,14H,7-10H2,1-6H3/t12-,14-/m0/s1 |
| InChIKey | BLSAARRKRHVKJD-JSGCOSHPSA-N |
| XLogP | 2.05 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|