C9H13N3O — CID 175893574
2-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]prop-2-enamide (PubChem CID 175893574) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]prop-2-enamide.
| Compound Name | 2-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 175893574 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 2-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=C(C(N)=O)[C@H]1C[C@@H](C)N(C#N)C1 |
| InChI | InChI=1S/C9H13N3O/c1-6-3-8(4-12(6)5-10)7(2)9(11)13/h6,8H,2-4H2,1H3,(H2,11,13)/t6-,8+/m1/s1 |
| InChIKey | TZMZPTIEJWHGBG-SVRRBLITSA-N |
| XLogP | 0.22 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|