C18H34N4O5S — CID 175893638
(2S)-6-acetamido-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid (PubChem CID 175893638) has the molecular formula C18H34N4O5S and a molecular weight of 418.56 g/mol. Its IUPAC name is (2S)-6-acetamido-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-acetamido-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175893638 |
| Molecular Formula | C18H34N4O5S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (2S)-6-acetamido-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid |
| SMILES | CSCC[C@H](N)C(=O)N[C@H](C(=O)N[C@@H](CCCCNC(C)=O)C(=O)O)C(C)C |
| InChI | InChI=1S/C18H34N4O5S/c1-11(2)15(22-16(24)13(19)8-10-28-4)17(25)21-14(18(26)27)7-5-6-9-20-12(3)23/h11,13-15H,5-10,19H2,1-4H3,(H,20,23)(H,21,25)(H,22,24)(H,26,27)/t13-,14-,15-/m0/s1 |
| InChIKey | XFGQQJSLMRDOSL-KKUMJFAQSA-N |
| XLogP | 0.08 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|