C19H23F3N4O2 — CID 175895011
butyl N-[[4-[4-(trifluoromethyl)phenyl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-6-yl]methyl]carbamate (PubChem CID 175895011) has the molecular formula C19H23F3N4O2 and a molecular weight of 396.41 g/mol. Its IUPAC name is butyl N-[[4-[4-(trifluoromethyl)phenyl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-6-yl]methyl]carbamate.
| Compound Name | butyl N-[[4-[4-(trifluoromethyl)phenyl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-6-yl]methyl]carbamate |
|---|---|
| PubChem CID | 175895011 |
| Molecular Formula | C19H23F3N4O2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | butyl N-[[4-[4-(trifluoromethyl)phenyl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-6-yl]methyl]carbamate |
| SMILES | CCCCOC(=O)NCC1CN(c2ccc(C(F)(F)F)cc2)c2ccnn2C1 |
| InChI | InChI=1S/C19H23F3N4O2/c1-2-3-10-28-18(27)23-11-14-12-25(17-8-9-24-26(17)13-14)16-6-4-15(5-7-16)19(20,21)22/h4-9,14H,2-3,10-13H2,1H3,(H,23,27) |
| InChIKey | WWDFDROEOUNWDD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|