C29H31Cl2N7O2 — CID 175899330
(1R,2S,5S)-N-[(5-chloroisoquinolin-4-yl)-cyanomethyl]-3-[(2S)-2-[(3-chloropyrazin-2-yl)amino]-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 175899330) has the molecular formula C29H31Cl2N7O2 and a molecular weight of 580.52 g/mol. Its IUPAC name is (1R,2S,5S)-N-[(5-chloroisoquinolin-4-yl)-cyanomethyl]-3-[(2S)-2-[(3-chloropyrazin-2-yl)amino]-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[(5-chloroisoquinolin-4-yl)-cyanomethyl]-3-[(2S)-2-[(3-chloropyrazin-2-yl)amino]-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 175899330 |
| Molecular Formula | C29H31Cl2N7O2 |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | (1R,2S,5S)-N-[(5-chloroisoquinolin-4-yl)-cyanomethyl]-3-[(2S)-2-[(3-chloropyrazin-2-yl)amino]-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)(C)[C@H](Nc1nccnc1Cl)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(C#N)c1cncc3cccc(Cl)c13)C2(C)C |
| InChI | InChI=1S/C29H31Cl2N7O2/c1-28(2,3)23(37-25-24(31)34-9-10-35-25)27(40)38-14-17-21(29(17,4)5)22(38)26(39)36-19(11-32)16-13-33-12-15-7-6-8-18(30)20(15)16/h6-10,12-13,17,19,21-23H,14H2,1-5H3,(H,35,37)(H,36,39)/t17-,19?,21-,22-,23+/m0/s1 |
| InChIKey | CJJDVCKTSMULRI-ARCOWLEXSA-N |
| XLogP | 5.02 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |