C32H37N5O4S — CID 174232800
(1R,2S,5S)-N-[cyano(isoquinolin-4-yl)methyl]-3-[3,3-dimethyl-2-[(4-methylphenyl)sulfonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 174232800) has the molecular formula C32H37N5O4S and a molecular weight of 587.75 g/mol. Its IUPAC name is (1R,2S,5S)-N-[cyano(isoquinolin-4-yl)methyl]-3-[3,3-dimethyl-2-[(4-methylphenyl)sulfonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[cyano(isoquinolin-4-yl)methyl]-3-[3,3-dimethyl-2-[(4-methylphenyl)sulfonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 174232800 |
| Molecular Formula | C32H37N5O4S |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | (1R,2S,5S)-N-[cyano(isoquinolin-4-yl)methyl]-3-[3,3-dimethyl-2-[(4-methylphenyl)sulfonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)NC(C#N)c2cncc4ccccc24)C3(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H37N5O4S/c1-19-11-13-21(14-12-19)42(40,41)36-28(31(2,3)4)30(39)37-18-24-26(32(24,5)6)27(37)29(38)35-25(15-33)23-17-34-16-20-9-7-8-10-22(20)23/h7-14,16-17,24-28,36H,18H2,1-6H3,(H,35,38)/t24-,25?,26-,27-,28?/m0/s1 |
| InChIKey | DMWXCIMCLJLRLF-UEDNBJCUSA-N |
| XLogP | 4.10 |
| TPSA | 132.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |