About methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate
methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate (PubChem CID 175899462) has the molecular formula C12H15N3O3
and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate |
| PubChem CID | 175899462 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(n1)NCN2C[C@@H]1CCO1 |
| InChI | InChI=1S/C12H15N3O3/c1-17-12(16)9-2-3-10-11(14-9)13-7-15(10)6-8-4-5-18-8/h2-3,8H,4-7H2,1H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | YIJZTBJAMCGOSY-QMMMGPOBSA-N |
| XLogP | 0.85 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate?
The IUPAC name of methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate (CID 175899462) is methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate.
What is the SMILES notation for methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate?
The canonical SMILES for methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate is COC(=O)c1ccc2c(n1)NCN2C[C@@H]1CCO1.
What is the InChIKey of methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate?
The InChIKey is YIJZTBJAMCGOSY-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H15N3O3/c1-17-12(16)9-2-3-10-11(14-9)13-7-15(10)6-8-4-5-18-8/h2-3,8H,4-7H2,1H3,(H,13,14)/t8-/m0/s1.
What are the key properties of methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate?
methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate has a molecular weight of 249.27 g/mol, XLogP of 0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[[(2S)-oxetan-2-yl]methyl]-2,3-dihydroimidazo[4,5-b]pyridine-5-carboxylate is sourced from PubChem (CID 175899462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).