C16H23ClN2O3 — CID 162737392
ethane;methyl 2-(chloromethyl)-3-(oxetan-2-ylmethyl)-1,2-dihydrobenzimidazole-5-carboxylate (PubChem CID 162737392) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is ethane;methyl 2-(chloromethyl)-3-(oxetan-2-ylmethyl)-1,2-dihydrobenzimidazole-5-carboxylate.
| Compound Name | ethane;methyl 2-(chloromethyl)-3-(oxetan-2-ylmethyl)-1,2-dihydrobenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 162737392 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | ethane;methyl 2-(chloromethyl)-3-(oxetan-2-ylmethyl)-1,2-dihydrobenzimidazole-5-carboxylate |
| SMILES | CC.COC(=O)c1ccc2c(c1)N(CC1CCO1)C(CCl)N2 |
| InChI | InChI=1S/C14H17ClN2O3.C2H6/c1-19-14(18)9-2-3-11-12(6-9)17(13(7-15)16-11)8-10-4-5-20-10;1-2/h2-3,6,10,13,16H,4-5,7-8H2,1H3;1-2H3 |
| InChIKey | KZHATRFJWCFMQQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|