C16H21NO4 — CID 11312358
methyl (3aS,4R,9bS)-4-(3-hydroxypropyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-carboxylate (PubChem CID 11312358) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl (3aS,4R,9bS)-4-(3-hydroxypropyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-carboxylate.
| Compound Name | methyl (3aS,4R,9bS)-4-(3-hydroxypropyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 11312358 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl (3aS,4R,9bS)-4-(3-hydroxypropyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@H]1OCC[C@H]1[C@@H](CCCO)N2 |
| InChI | InChI=1S/C16H21NO4/c1-20-16(19)10-4-5-14-12(9-10)15-11(6-8-21-15)13(17-14)3-2-7-18/h4-5,9,11,13,15,17-18H,2-3,6-8H2,1H3/t11-,13+,15-/m0/s1 |
| InChIKey | JVGYOJLHITXJGM-LNSITVRQSA-N |
| XLogP | 2.12 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |