About methyl benzoate;3-(oxiran-2-yl)propan-1-ol
methyl benzoate;3-(oxiran-2-yl)propan-1-ol (PubChem CID 174580613) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is methyl benzoate;3-(oxiran-2-yl)propan-1-ol.
Molecular Properties
| Compound Name | methyl benzoate;3-(oxiran-2-yl)propan-1-ol |
| PubChem CID | 174580613 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | methyl benzoate;3-(oxiran-2-yl)propan-1-ol |
| SMILES | COC(=O)c1ccccc1.OCCCC1CO1 |
| InChI | InChI=1S/C8H8O2.C5H10O2/c1-10-8(9)7-5-3-2-4-6-7;6-3-1-2-5-4-7-5/h2-6H,1H3;5-6H,1-4H2 |
| InChIKey | NJPZTRRQQWLUFB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methyl benzoate;3-(oxiran-2-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl benzoate;3-(oxiran-2-yl)propan-1-ol?
The IUPAC name of methyl benzoate;3-(oxiran-2-yl)propan-1-ol (CID 174580613) is methyl benzoate;3-(oxiran-2-yl)propan-1-ol.
What is the SMILES notation for methyl benzoate;3-(oxiran-2-yl)propan-1-ol?
The canonical SMILES for methyl benzoate;3-(oxiran-2-yl)propan-1-ol is COC(=O)c1ccccc1.OCCCC1CO1.
What is the InChIKey of methyl benzoate;3-(oxiran-2-yl)propan-1-ol?
The InChIKey is NJPZTRRQQWLUFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C5H10O2/c1-10-8(9)7-5-3-2-4-6-7;6-3-1-2-5-4-7-5/h2-6H,1H3;5-6H,1-4H2.
What are the key properties of methyl benzoate;3-(oxiran-2-yl)propan-1-ol?
methyl benzoate;3-(oxiran-2-yl)propan-1-ol has a molecular weight of 238.28 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl benzoate;3-(oxiran-2-yl)propan-1-ol is sourced from PubChem (CID 174580613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).