About dioxolan-4-amine;methyl benzoate
dioxolan-4-amine;methyl benzoate (PubChem CID 87476629) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is dioxolan-4-amine;methyl benzoate.
Molecular Properties
| Compound Name | dioxolan-4-amine;methyl benzoate |
| PubChem CID | 87476629 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | dioxolan-4-amine;methyl benzoate |
| SMILES | COC(=O)c1ccccc1.NC1COOC1 |
| InChI | InChI=1S/C8H8O2.C3H7NO2/c1-10-8(9)7-5-3-2-4-6-7;4-3-1-5-6-2-3/h2-6H,1H3;3H,1-2,4H2 |
| InChIKey | NJWPPLRIBGDOJC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze dioxolan-4-amine;methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxolan-4-amine;methyl benzoate?
The IUPAC name of dioxolan-4-amine;methyl benzoate (CID 87476629) is dioxolan-4-amine;methyl benzoate.
What is the SMILES notation for dioxolan-4-amine;methyl benzoate?
The canonical SMILES for dioxolan-4-amine;methyl benzoate is COC(=O)c1ccccc1.NC1COOC1.
What is the InChIKey of dioxolan-4-amine;methyl benzoate?
The InChIKey is NJWPPLRIBGDOJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C3H7NO2/c1-10-8(9)7-5-3-2-4-6-7;4-3-1-5-6-2-3/h2-6H,1H3;3H,1-2,4H2.
What are the key properties of dioxolan-4-amine;methyl benzoate?
dioxolan-4-amine;methyl benzoate has a molecular weight of 225.24 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dioxolan-4-amine;methyl benzoate is sourced from PubChem (CID 87476629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).