C17H21NO3 — CID 11173718
methyl (3aR,4R,9bS)-4-(3-hydroxypropyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 11173718) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl (3aR,4R,9bS)-4-(3-hydroxypropyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | methyl (3aR,4R,9bS)-4-(3-hydroxypropyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 11173718 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | methyl (3aR,4R,9bS)-4-(3-hydroxypropyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](CCCO)N2 |
| InChI | InChI=1S/C17H21NO3/c1-21-17(20)11-7-8-16-14(10-11)12-4-2-5-13(12)15(18-16)6-3-9-19/h2,4,7-8,10,12-13,15,18-19H,3,5-6,9H2,1H3/t12-,13+,15+/m0/s1 |
| InChIKey | FIKRUCNTXKFLCX-GZBFAFLISA-N |
| XLogP | 2.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|