C15H13F3N2O3 — CID 175901418
2-[3-(3,3-difluoroazetidine-1-carbonyl)azetidine-1-carbonyl]-4-fluorobenzaldehyde (PubChem CID 175901418) has the molecular formula C15H13F3N2O3 and a molecular weight of 326.27 g/mol. Its IUPAC name is 2-[3-(3,3-difluoroazetidine-1-carbonyl)azetidine-1-carbonyl]-4-fluorobenzaldehyde.
| Compound Name | 2-[3-(3,3-difluoroazetidine-1-carbonyl)azetidine-1-carbonyl]-4-fluorobenzaldehyde |
|---|---|
| PubChem CID | 175901418 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[3-(3,3-difluoroazetidine-1-carbonyl)azetidine-1-carbonyl]-4-fluorobenzaldehyde |
| SMILES | O=Cc1ccc(F)cc1C(=O)N1CC(C(=O)N2CC(F)(F)C2)C1 |
| InChI | InChI=1S/C15H13F3N2O3/c16-11-2-1-9(6-21)12(3-11)14(23)19-4-10(5-19)13(22)20-7-15(17,18)8-20/h1-3,6,10H,4-5,7-8H2 |
| InChIKey | JGYFIIRHRIGNRD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|