About 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one
6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one (PubChem CID 176972275) has the molecular formula C15H10ClF3N2O2
and a molecular weight of 342.70 g/mol. Its IUPAC name is 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one |
| PubChem CID | 176972275 |
| Molecular Formula | C15H10ClF3N2O2 |
| Molecular Weight | 342.70 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one |
| SMILES | O=C(c1cc(F)ccc1-c1cc(Cl)[nH]c(=O)c1)N1CC(F)(F)C1 |
| InChI | InChI=1S/C15H10ClF3N2O2/c16-12-3-8(4-13(22)20-12)10-2-1-9(17)5-11(10)14(23)21-6-15(18,19)7-21/h1-5H,6-7H2,(H,20,22) |
| InChIKey | MQGNLFQXKNOOBZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.70 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one?
The IUPAC name of 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one (CID 176972275) is 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one.
What is the SMILES notation for 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one?
The canonical SMILES for 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one is O=C(c1cc(F)ccc1-c1cc(Cl)[nH]c(=O)c1)N1CC(F)(F)C1.
What is the InChIKey of 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one?
The InChIKey is MQGNLFQXKNOOBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClF3N2O2/c16-12-3-8(4-13(22)20-12)10-2-1-9(17)5-11(10)14(23)21-6-15(18,19)7-21/h1-5H,6-7H2,(H,20,22).
What are the key properties of 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one?
6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one has a molecular weight of 342.70 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-[2-(3,3-difluoroazetidine-1-carbonyl)-4-fluorophenyl]-1H-pyridin-2-one is sourced from PubChem (CID 176972275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).