C17H12Cl2F4N2O2 — CID 176972538
[5-chloro-2-[2-chloro-6-(2,2-difluoroethoxy)-4-pyridinyl]phenyl]-(3,3-difluoroazetidin-1-yl)methanone (PubChem CID 176972538) has the molecular formula C17H12Cl2F4N2O2 and a molecular weight of 423.19 g/mol. Its IUPAC name is [5-chloro-2-[2-chloro-6-(2,2-difluoroethoxy)-4-pyridinyl]phenyl]-(3,3-difluoroazetidin-1-yl)methanone.
| Compound Name | [5-chloro-2-[2-chloro-6-(2,2-difluoroethoxy)-4-pyridinyl]phenyl]-(3,3-difluoroazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 176972538 |
| Molecular Formula | C17H12Cl2F4N2O2 |
| Molecular Weight | 423.19 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | [5-chloro-2-[2-chloro-6-(2,2-difluoroethoxy)-4-pyridinyl]phenyl]-(3,3-difluoroazetidin-1-yl)methanone |
| SMILES | O=C(c1cc(Cl)ccc1-c1cc(Cl)nc(OCC(F)F)c1)N1CC(F)(F)C1 |
| InChI | InChI=1S/C17H12Cl2F4N2O2/c18-10-1-2-11(12(5-10)16(26)25-7-17(22,23)8-25)9-3-13(19)24-15(4-9)27-6-14(20)21/h1-5,14H,6-8H2 |
| InChIKey | SRFSSTJFZXDLMO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.19 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|