C19H25N3O3 — CID 175901634
N-[(3-methoxyphenyl)methyl]-2-(2-morpholin-4-ylethoxy)pyridin-4-amine (PubChem CID 175901634) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-2-(2-morpholin-4-ylethoxy)pyridin-4-amine.
| Compound Name | N-[(3-methoxyphenyl)methyl]-2-(2-morpholin-4-ylethoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 175901634 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-2-(2-morpholin-4-ylethoxy)pyridin-4-amine |
| SMILES | COc1cccc(CNc2ccnc(OCCN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C19H25N3O3/c1-23-18-4-2-3-16(13-18)15-21-17-5-6-20-19(14-17)25-12-9-22-7-10-24-11-8-22/h2-6,13-14H,7-12,15H2,1H3,(H,20,21) |
| InChIKey | VSHFZYYSFQGCAR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |